C6H11N7O2 — CID 25243680
3-[(4-amino-6-hydrazinyl-1,3,5-triazin-2-yl)amino]propanoic acid (PubChem CID 25243680) has the molecular formula C6H11N7O2 and a molecular weight of 213.20 g/mol. Its IUPAC name is 3-[(4-amino-6-hydrazinyl-1,3,5-triazin-2-yl)amino]propanoic acid.
| Compound Name | 3-[(4-amino-6-hydrazinyl-1,3,5-triazin-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 25243680 |
| Molecular Formula | C6H11N7O2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 3-[(4-amino-6-hydrazinyl-1,3,5-triazin-2-yl)amino]propanoic acid |
| SMILES | NNc1nc(N)nc(NCCC(=O)O)n1 |
| InChI | InChI=1S/C6H11N7O2/c7-4-10-5(9-2-1-3(14)15)12-6(11-4)13-8/h1-2,8H2,(H,14,15)(H4,7,9,10,11,12,13) |
| InChIKey | XDACPXUEEIPMSW-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 152.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|