C21H29N7OSi — CID 25242687
2-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-hydrazinyl-1,3,5-triazine-2,4-diamine (PubChem CID 25242687) has the molecular formula C21H29N7OSi and a molecular weight of 423.60 g/mol. Its IUPAC name is 2-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-hydrazinyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-hydrazinyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 25242687 |
| Molecular Formula | C21H29N7OSi |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 2-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-hydrazinyl-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)(C)[Si](OCCNc1nc(N)nc(NN)n1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H29N7OSi/c1-21(2,3)30(16-10-6-4-7-11-16,17-12-8-5-9-13-17)29-15-14-24-19-25-18(22)26-20(27-19)28-23/h4-13H,14-15,23H2,1-3H3,(H4,22,24,25,26,27,28) |
| InChIKey | KJIDNUKPZKMTJK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|