C32H40N6O3Si — CID 21051790
4-N-benzyl-2-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-N-ethyl-6-N-methyl-5-nitropyrimidine-2,4,6-triamine (PubChem CID 21051790) has the molecular formula C32H40N6O3Si and a molecular weight of 584.80 g/mol. Its IUPAC name is 4-N-benzyl-2-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-N-ethyl-6-N-methyl-5-nitropyrimidine-2,4,6-triamine.
| Compound Name | 4-N-benzyl-2-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-N-ethyl-6-N-methyl-5-nitropyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 21051790 |
| Molecular Formula | C32H40N6O3Si |
| Molecular Weight | 584.80 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | 4-N-benzyl-2-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-N-ethyl-6-N-methyl-5-nitropyrimidine-2,4,6-triamine |
| SMILES | CCN(Cc1ccccc1)c1nc(NCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)nc(NC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C32H40N6O3Si/c1-6-37(24-25-16-10-7-11-17-25)30-28(38(39)40)29(33-5)35-31(36-30)34-22-23-41-42(32(2,3)4,26-18-12-8-13-19-26)27-20-14-9-15-21-27/h7-21H,6,22-24H2,1-5H3,(H2,33,34,35,36) |
| InChIKey | FWXRUMPSRXZOLX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.80 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|