C23H21ClN4O2 — CID 140982169
2-N,2-N-dibenzyl-3-nitroquinoline-2,4-diamine;hydrochloride (PubChem CID 140982169) has the molecular formula C23H21ClN4O2 and a molecular weight of 420.90 g/mol. Its IUPAC name is 2-N,2-N-dibenzyl-3-nitroquinoline-2,4-diamine;hydrochloride.
| Compound Name | 2-N,2-N-dibenzyl-3-nitroquinoline-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 140982169 |
| Molecular Formula | C23H21ClN4O2 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-N,2-N-dibenzyl-3-nitroquinoline-2,4-diamine;hydrochloride |
| SMILES | Cl.Nc1c([N+](=O)[O-])c(N(Cc2ccccc2)Cc2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C23H20N4O2.ClH/c24-21-19-13-7-8-14-20(19)25-23(22(21)27(28)29)26(15-17-9-3-1-4-10-17)16-18-11-5-2-6-12-18;/h1-14H,15-16H2,(H2,24,25);1H |
| InChIKey | DSYDNDIXUDMIIN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|