C27H30N4 — CID 57159810
2-N,2-N-dibenzyl-4-N-(2-methylpropyl)quinoline-2,3,4-triamine (PubChem CID 57159810) has the molecular formula C27H30N4 and a molecular weight of 410.56 g/mol. Its IUPAC name is 2-N,2-N-dibenzyl-4-N-(2-methylpropyl)quinoline-2,3,4-triamine.
| Compound Name | 2-N,2-N-dibenzyl-4-N-(2-methylpropyl)quinoline-2,3,4-triamine |
|---|---|
| PubChem CID | 57159810 |
| Molecular Formula | C27H30N4 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 2-N,2-N-dibenzyl-4-N-(2-methylpropyl)quinoline-2,3,4-triamine |
| SMILES | CC(C)CNc1c(N)c(N(Cc2ccccc2)Cc2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C27H30N4/c1-20(2)17-29-26-23-15-9-10-16-24(23)30-27(25(26)28)31(18-21-11-5-3-6-12-21)19-22-13-7-4-8-14-22/h3-16,20H,17-19,28H2,1-2H3,(H,29,30) |
| InChIKey | QOWUOXGDRYUYIZ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |