C19H18N4O2 — CID 164532342
4,6-dibenzyl-3-nitropyridine-2,5-diamine (PubChem CID 164532342) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 4,6-dibenzyl-3-nitropyridine-2,5-diamine.
| Compound Name | 4,6-dibenzyl-3-nitropyridine-2,5-diamine |
|---|---|
| PubChem CID | 164532342 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4,6-dibenzyl-3-nitropyridine-2,5-diamine |
| SMILES | Nc1nc(Cc2ccccc2)c(N)c(Cc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18N4O2/c20-17-15(11-13-7-3-1-4-8-13)18(23(24)25)19(21)22-16(17)12-14-9-5-2-6-10-14/h1-10H,11-12,20H2,(H2,21,22) |
| InChIKey | OHOWFGCKGCTUFD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|