C11H10BrN5O2 — CID 91075958
6-[(2-bromophenyl)methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 91075958) has the molecular formula C11H10BrN5O2 and a molecular weight of 324.14 g/mol. Its IUPAC name is 6-[(2-bromophenyl)methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 6-[(2-bromophenyl)methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 91075958 |
| Molecular Formula | C11H10BrN5O2 |
| Molecular Weight | 324.14 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 6-[(2-bromophenyl)methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | Nc1nc(N)c([N+](=O)[O-])c(Cc2ccccc2Br)n1 |
| InChI | InChI=1S/C11H10BrN5O2/c12-7-4-2-1-3-6(7)5-8-9(17(18)19)10(13)16-11(14)15-8/h1-4H,5H2,(H4,13,14,15,16) |
| InChIKey | KTEJMXHGRGETBA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.14 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|