C20H27ClN6O2 — CID 90816595
4-N-[[4-(aminomethyl)cyclohexyl]methyl]-6-[(3-chloro-2-methylphenyl)methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 90816595) has the molecular formula C20H27ClN6O2 and a molecular weight of 418.93 g/mol. Its IUPAC name is 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-6-[(3-chloro-2-methylphenyl)methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-6-[(3-chloro-2-methylphenyl)methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 90816595 |
| Molecular Formula | C20H27ClN6O2 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-6-[(3-chloro-2-methylphenyl)methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | Cc1c(Cl)cccc1Cc1nc(N)nc(NCC2CCC(CN)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H27ClN6O2/c1-12-15(3-2-4-16(12)21)9-17-18(27(28)29)19(26-20(23)25-17)24-11-14-7-5-13(10-22)6-8-14/h2-4,13-14H,5-11,22H2,1H3,(H3,23,24,25,26) |
| InChIKey | UDIQTHDSIOZLIW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|