C19H26N6O3 — CID 68798682
6-[(2-methoxyphenyl)methyl]-4-N-[(1-methylpiperidin-4-yl)methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 68798682) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is 6-[(2-methoxyphenyl)methyl]-4-N-[(1-methylpiperidin-4-yl)methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 6-[(2-methoxyphenyl)methyl]-4-N-[(1-methylpiperidin-4-yl)methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68798682 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 6-[(2-methoxyphenyl)methyl]-4-N-[(1-methylpiperidin-4-yl)methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | COc1ccccc1Cc1nc(N)nc(NCC2CCN(C)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H26N6O3/c1-24-9-7-13(8-10-24)12-21-18-17(25(26)27)15(22-19(20)23-18)11-14-5-3-4-6-16(14)28-2/h3-6,13H,7-12H2,1-2H3,(H3,20,21,22,23) |
| InChIKey | AHJINCWKYPQJTH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|