C15H21N5 — CID 102984126
3-N-[(1-methylpiperidin-4-yl)methyl]quinoxaline-2,3-diamine (PubChem CID 102984126) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 3-N-[(1-methylpiperidin-4-yl)methyl]quinoxaline-2,3-diamine.
| Compound Name | 3-N-[(1-methylpiperidin-4-yl)methyl]quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 102984126 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 3-N-[(1-methylpiperidin-4-yl)methyl]quinoxaline-2,3-diamine |
| SMILES | CN1CCC(CNc2nc3ccccc3nc2N)CC1 |
| InChI | InChI=1S/C15H21N5/c1-20-8-6-11(7-9-20)10-17-15-14(16)18-12-4-2-3-5-13(12)19-15/h2-5,11H,6-10H2,1H3,(H2,16,18)(H,17,19) |
| InChIKey | GHAUAGPECABEAE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |