C13H16N4S — CID 102984663
3-N-(thiolan-2-ylmethyl)quinoxaline-2,3-diamine (PubChem CID 102984663) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is 3-N-(thiolan-2-ylmethyl)quinoxaline-2,3-diamine.
| Compound Name | 3-N-(thiolan-2-ylmethyl)quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 102984663 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 3-N-(thiolan-2-ylmethyl)quinoxaline-2,3-diamine |
| SMILES | Nc1nc2ccccc2nc1NCC1CCCS1 |
| InChI | InChI=1S/C13H16N4S/c14-12-13(15-8-9-4-3-7-18-9)17-11-6-2-1-5-10(11)16-12/h1-2,5-6,9H,3-4,7-8H2,(H2,14,16)(H,15,17) |
| InChIKey | KTEQHBPRMVMLIC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |