C22H23F3N6O2S — CID 68799539
6-[[4-[(dimethylamino)methyl]phenyl]methyl]-5-nitro-2-N-[[2-(trifluoromethylsulfanyl)phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 68799539) has the molecular formula C22H23F3N6O2S and a molecular weight of 492.53 g/mol. Its IUPAC name is 6-[[4-[(dimethylamino)methyl]phenyl]methyl]-5-nitro-2-N-[[2-(trifluoromethylsulfanyl)phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 6-[[4-[(dimethylamino)methyl]phenyl]methyl]-5-nitro-2-N-[[2-(trifluoromethylsulfanyl)phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68799539 |
| Molecular Formula | C22H23F3N6O2S |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 6-[[4-[(dimethylamino)methyl]phenyl]methyl]-5-nitro-2-N-[[2-(trifluoromethylsulfanyl)phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | CN(C)Cc1ccc(Cc2nc(NCc3ccccc3SC(F)(F)F)nc(N)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H23F3N6O2S/c1-30(2)13-15-9-7-14(8-10-15)11-17-19(31(32)33)20(26)29-21(28-17)27-12-16-5-3-4-6-18(16)34-22(23,24)25/h3-10H,11-13H2,1-2H3,(H3,26,27,28,29) |
| InChIKey | KBWDLNHQNRGESN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|