C19H25BrN6O2 — CID 68801500
6-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[(4-bromophenyl)methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 68801500) has the molecular formula C19H25BrN6O2 and a molecular weight of 449.35 g/mol. Its IUPAC name is 6-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[(4-bromophenyl)methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 6-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[(4-bromophenyl)methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68801500 |
| Molecular Formula | C19H25BrN6O2 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 6-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[(4-bromophenyl)methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | NCC1CCC(Cc2nc(NCc3ccc(Br)cc3)nc(N)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H25BrN6O2/c20-15-7-5-14(6-8-15)11-23-19-24-16(17(26(27)28)18(22)25-19)9-12-1-3-13(10-21)4-2-12/h5-8,12-13H,1-4,9-11,21H2,(H3,22,23,24,25) |
| InChIKey | KIQZYDARTKWIBD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|