C18H29N7O3 — CID 69059650
2-[[4-amino-6-[(4-aminocyclohexyl)methyl]-5-nitropyrimidin-2-yl]amino]-1-piperidin-1-ylethanone (PubChem CID 69059650) has the molecular formula C18H29N7O3 and a molecular weight of 391.48 g/mol. Its IUPAC name is 2-[[4-amino-6-[(4-aminocyclohexyl)methyl]-5-nitropyrimidin-2-yl]amino]-1-piperidin-1-ylethanone.
| Compound Name | 2-[[4-amino-6-[(4-aminocyclohexyl)methyl]-5-nitropyrimidin-2-yl]amino]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 69059650 |
| Molecular Formula | C18H29N7O3 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 2-[[4-amino-6-[(4-aminocyclohexyl)methyl]-5-nitropyrimidin-2-yl]amino]-1-piperidin-1-ylethanone |
| SMILES | Nc1nc(NCC(=O)N2CCCCC2)nc(CC2CCC(N)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H29N7O3/c19-13-6-4-12(5-7-13)10-14-16(25(27)28)17(20)23-18(22-14)21-11-15(26)24-8-2-1-3-9-24/h12-13H,1-11,19H2,(H3,20,21,22,23) |
| InChIKey | MSCJUWQFDQIKPZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 153.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|