C20H26F2N6O3 — CID 68799930
6-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[[3-(difluoromethoxy)phenyl]methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 68799930) has the molecular formula C20H26F2N6O3 and a molecular weight of 436.46 g/mol. Its IUPAC name is 6-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[[3-(difluoromethoxy)phenyl]methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 6-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[[3-(difluoromethoxy)phenyl]methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68799930 |
| Molecular Formula | C20H26F2N6O3 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 6-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[[3-(difluoromethoxy)phenyl]methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | NCC1CCC(Cc2nc(NCc3cccc(OC(F)F)c3)nc(N)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H26F2N6O3/c21-19(22)31-15-3-1-2-14(8-15)11-25-20-26-16(17(28(29)30)18(24)27-20)9-12-4-6-13(10-23)7-5-12/h1-3,8,12-13,19H,4-7,9-11,23H2,(H3,24,25,26,27) |
| InChIKey | VNIAWGDTZMULKP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|