C13H12F2IN3O — CID 138522608
3-N-[[3-(difluoromethoxy)phenyl]methyl]-5-iodopyridine-2,3-diamine (PubChem CID 138522608) has the molecular formula C13H12F2IN3O and a molecular weight of 391.16 g/mol. Its IUPAC name is 3-N-[[3-(difluoromethoxy)phenyl]methyl]-5-iodopyridine-2,3-diamine.
| Compound Name | 3-N-[[3-(difluoromethoxy)phenyl]methyl]-5-iodopyridine-2,3-diamine |
|---|---|
| PubChem CID | 138522608 |
| Molecular Formula | C13H12F2IN3O |
| Molecular Weight | 391.16 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 3-N-[[3-(difluoromethoxy)phenyl]methyl]-5-iodopyridine-2,3-diamine |
| SMILES | Nc1ncc(I)cc1NCc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C13H12F2IN3O/c14-13(15)20-10-3-1-2-8(4-10)6-18-11-5-9(16)7-19-12(11)17/h1-5,7,13,18H,6H2,(H2,17,19) |
| InChIKey | FQPDQNOCNJHKRD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.16 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|