C15H13F4NO3S — CID 133300175
N-[[3-(difluoromethoxy)phenyl]methyl]-2-(difluoromethylsulfonyl)aniline (PubChem CID 133300175) has the molecular formula C15H13F4NO3S and a molecular weight of 363.33 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)phenyl]methyl]-2-(difluoromethylsulfonyl)aniline.
| Compound Name | N-[[3-(difluoromethoxy)phenyl]methyl]-2-(difluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 133300175 |
| Molecular Formula | C15H13F4NO3S |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | N-[[3-(difluoromethoxy)phenyl]methyl]-2-(difluoromethylsulfonyl)aniline |
| SMILES | O=S(=O)(c1ccccc1NCc1cccc(OC(F)F)c1)C(F)F |
| InChI | InChI=1S/C15H13F4NO3S/c16-14(17)23-11-5-3-4-10(8-11)9-20-12-6-1-2-7-13(12)24(21,22)15(18)19/h1-8,14-15,20H,9H2 |
| InChIKey | BMLKSQUYPFEXKW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |