C22H20F2N2O3S — CID 133297905
N-[3-[[2-(difluoromethylsulfonyl)anilino]methyl]phenyl]-4-methylbenzamide (PubChem CID 133297905) has the molecular formula C22H20F2N2O3S and a molecular weight of 430.48 g/mol. Its IUPAC name is N-[3-[[2-(difluoromethylsulfonyl)anilino]methyl]phenyl]-4-methylbenzamide.
| Compound Name | N-[3-[[2-(difluoromethylsulfonyl)anilino]methyl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 133297905 |
| Molecular Formula | C22H20F2N2O3S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | N-[3-[[2-(difluoromethylsulfonyl)anilino]methyl]phenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(CNc3ccccc3S(=O)(=O)C(F)F)c2)cc1 |
| InChI | InChI=1S/C22H20F2N2O3S/c1-15-9-11-17(12-10-15)21(27)26-18-6-4-5-16(13-18)14-25-19-7-2-3-8-20(19)30(28,29)22(23)24/h2-13,22,25H,14H2,1H3,(H,26,27) |
| InChIKey | VHSRNIGDVWPYCM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |