C18H21ClF2N2O3S — CID 119438655
4-(difluoromethylsulfonylmethyl)-N-[3-(ethylaminomethyl)phenyl]benzamide;hydrochloride (PubChem CID 119438655) has the molecular formula C18H21ClF2N2O3S and a molecular weight of 418.89 g/mol. Its IUPAC name is 4-(difluoromethylsulfonylmethyl)-N-[3-(ethylaminomethyl)phenyl]benzamide;hydrochloride.
| Compound Name | 4-(difluoromethylsulfonylmethyl)-N-[3-(ethylaminomethyl)phenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119438655 |
| Molecular Formula | C18H21ClF2N2O3S |
| Molecular Weight | 418.89 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 4-(difluoromethylsulfonylmethyl)-N-[3-(ethylaminomethyl)phenyl]benzamide;hydrochloride |
| SMILES | CCNCc1cccc(NC(=O)c2ccc(CS(=O)(=O)C(F)F)cc2)c1.Cl |
| InChI | InChI=1S/C18H20F2N2O3S.ClH/c1-2-21-11-14-4-3-5-16(10-14)22-17(23)15-8-6-13(7-9-15)12-26(24,25)18(19)20;/h3-10,18,21H,2,11-12H2,1H3,(H,22,23);1H |
| InChIKey | IVVSXRWHCSJJFW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.89 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |