C24H26N2O — CID 27655051
4-methyl-N-[3-[[[(1S)-1-(2-methylphenyl)ethyl]amino]methyl]phenyl]benzamide (PubChem CID 27655051) has the molecular formula C24H26N2O and a molecular weight of 358.49 g/mol. Its IUPAC name is 4-methyl-N-[3-[[[(1S)-1-(2-methylphenyl)ethyl]amino]methyl]phenyl]benzamide.
| Compound Name | 4-methyl-N-[3-[[[(1S)-1-(2-methylphenyl)ethyl]amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 27655051 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 4-methyl-N-[3-[[[(1S)-1-(2-methylphenyl)ethyl]amino]methyl]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(CN[C@@H](C)c3ccccc3C)c2)cc1 |
| InChI | InChI=1S/C24H26N2O/c1-17-11-13-21(14-12-17)24(27)26-22-9-6-8-20(15-22)16-25-19(3)23-10-5-4-7-18(23)2/h4-15,19,25H,16H2,1-3H3,(H,26,27)/t19-/m0/s1 |
| InChIKey | DMORKIDDDZXERR-IBGZPJMESA-N |
| XLogP | 5.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |