C17H17F4NO4S — CID 78882962
N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-(difluoromethylsulfonyl)aniline (PubChem CID 78882962) has the molecular formula C17H17F4NO4S and a molecular weight of 407.39 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-(difluoromethylsulfonyl)aniline.
| Compound Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-(difluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 78882962 |
| Molecular Formula | C17H17F4NO4S |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-(difluoromethylsulfonyl)aniline |
| SMILES | CCOc1cc(CNc2ccccc2S(=O)(=O)C(F)F)ccc1OC(F)F |
| InChI | InChI=1S/C17H17F4NO4S/c1-2-25-14-9-11(7-8-13(14)26-16(18)19)10-22-12-5-3-4-6-15(12)27(23,24)17(20)21/h3-9,16-17,22H,2,10H2,1H3 |
| InChIKey | UESNSNMLPFSMRU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |