C18H29N7O4 — CID 59845661
2-[[4-[(4-aminocyclohexyl)methylamino]-5-nitropyrimidin-2-yl]amino]-1-[(3R)-3-hydroxypiperidin-1-yl]ethanone (PubChem CID 59845661) has the molecular formula C18H29N7O4 and a molecular weight of 407.48 g/mol. Its IUPAC name is 2-[[4-[(4-aminocyclohexyl)methylamino]-5-nitropyrimidin-2-yl]amino]-1-[(3R)-3-hydroxypiperidin-1-yl]ethanone.
| Compound Name | 2-[[4-[(4-aminocyclohexyl)methylamino]-5-nitropyrimidin-2-yl]amino]-1-[(3R)-3-hydroxypiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 59845661 |
| Molecular Formula | C18H29N7O4 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 2-[[4-[(4-aminocyclohexyl)methylamino]-5-nitropyrimidin-2-yl]amino]-1-[(3R)-3-hydroxypiperidin-1-yl]ethanone |
| SMILES | NC1CCC(CNc2nc(NCC(=O)N3CCC[C@@H](O)C3)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H29N7O4/c19-13-5-3-12(4-6-13)8-20-17-15(25(28)29)9-21-18(23-17)22-10-16(27)24-7-1-2-14(26)11-24/h9,12-14,26H,1-8,10-11,19H2,(H2,20,21,22,23)/t12?,13?,14-/m1/s1 |
| InChIKey | XEHPQUILGGLQOQ-JXQTWKCFSA-N |
| XLogP | 0.71 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|