C19H23BrClN5O3 — CID 69151135
[4-[[[2-[(3-bromo-2-chlorophenyl)methylamino]-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]methanol (PubChem CID 69151135) has the molecular formula C19H23BrClN5O3 and a molecular weight of 484.78 g/mol. Its IUPAC name is [4-[[[2-[(3-bromo-2-chlorophenyl)methylamino]-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]methanol.
| Compound Name | [4-[[[2-[(3-bromo-2-chlorophenyl)methylamino]-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 69151135 |
| Molecular Formula | C19H23BrClN5O3 |
| Molecular Weight | 484.78 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | [4-[[[2-[(3-bromo-2-chlorophenyl)methylamino]-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]methanol |
| SMILES | O=[N+]([O-])c1cnc(NCc2cccc(Br)c2Cl)nc1NCC1CCC(CO)CC1 |
| InChI | InChI=1S/C19H23BrClN5O3/c20-15-3-1-2-14(17(15)21)9-23-19-24-10-16(26(28)29)18(25-19)22-8-12-4-6-13(11-27)7-5-12/h1-3,10,12-13,27H,4-9,11H2,(H2,22,23,24,25) |
| InChIKey | FSYPJKFXAQOCOG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 113.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.78 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|