C19H23F3N6O2S — CID 150862296
5-nitro-4-N-(piperidin-4-ylmethyl)-2-N-[[2-(2,2,2-trifluoroethylsulfanyl)phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 150862296) has the molecular formula C19H23F3N6O2S and a molecular weight of 456.49 g/mol. Its IUPAC name is 5-nitro-4-N-(piperidin-4-ylmethyl)-2-N-[[2-(2,2,2-trifluoroethylsulfanyl)phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-nitro-4-N-(piperidin-4-ylmethyl)-2-N-[[2-(2,2,2-trifluoroethylsulfanyl)phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 150862296 |
| Molecular Formula | C19H23F3N6O2S |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 5-nitro-4-N-(piperidin-4-ylmethyl)-2-N-[[2-(2,2,2-trifluoroethylsulfanyl)phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | O=[N+]([O-])c1cnc(NCc2ccccc2SCC(F)(F)F)nc1NCC1CCNCC1 |
| InChI | InChI=1S/C19H23F3N6O2S/c20-19(21,22)12-31-16-4-2-1-3-14(16)10-25-18-26-11-15(28(29)30)17(27-18)24-9-13-5-7-23-8-6-13/h1-4,11,13,23H,5-10,12H2,(H2,24,25,26,27) |
| InChIKey | KSHKAUXAAVKFQH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|