C26H29F3N6O5S — CID 140540666
[3-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]phenyl]methanesulfonamide (PubChem CID 140540666) has the molecular formula C26H29F3N6O5S and a molecular weight of 594.62 g/mol. Its IUPAC name is [3-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]phenyl]methanesulfonamide.
| Compound Name | [3-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 140540666 |
| Molecular Formula | C26H29F3N6O5S |
| Molecular Weight | 594.62 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | [3-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]phenyl]methanesulfonamide |
| SMILES | NS(=O)(=O)Cc1cccc(C2CCC(CNc3nc(NCc4ccccc4OC(F)(F)F)ncc3[N+](=O)[O-])CC2)c1 |
| InChI | InChI=1S/C26H29F3N6O5S/c27-26(28,29)40-23-7-2-1-5-21(23)14-32-25-33-15-22(35(36)37)24(34-25)31-13-17-8-10-19(11-9-17)20-6-3-4-18(12-20)16-41(30,38)39/h1-7,12,15,17,19H,8-11,13-14,16H2,(H2,30,38,39)(H2,31,32,33,34) |
| InChIKey | GHFWBJODPSLTTJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 162.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|