C28H31F3N6O4 — CID 91195129
(2S)-2-[[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]-3-phenylpropanal (PubChem CID 91195129) has the molecular formula C28H31F3N6O4 and a molecular weight of 572.59 g/mol. Its IUPAC name is (2S)-2-[[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]-3-phenylpropanal.
| Compound Name | (2S)-2-[[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]-3-phenylpropanal |
|---|---|
| PubChem CID | 91195129 |
| Molecular Formula | C28H31F3N6O4 |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | (2S)-2-[[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]-3-phenylpropanal |
| SMILES | O=C[C@H](Cc1ccccc1)NC1CCC(CNc2nc(NCc3ccccc3OC(F)(F)F)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C28H31F3N6O4/c29-28(30,31)41-25-9-5-4-8-21(25)16-33-27-34-17-24(37(39)40)26(36-27)32-15-20-10-12-22(13-11-20)35-23(18-38)14-19-6-2-1-3-7-19/h1-9,17-18,20,22-23,35H,10-16H2,(H2,32,33,34,36)/t20?,22?,23-/m0/s1 |
| InChIKey | QAJOIYVLAXLKHH-SDVLMSEASA-N |
| XLogP | 5.27 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|