C24H30F3N7O4 — CID 69337617
(2S)-N-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]pyrrolidine-2-carboxamide (PubChem CID 69337617) has the molecular formula C24H30F3N7O4 and a molecular weight of 537.54 g/mol. Its IUPAC name is (2S)-N-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 69337617 |
| Molecular Formula | C24H30F3N7O4 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | (2S)-N-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NC1CCC(CNc2nc(NCc3ccccc3OC(F)(F)F)ncc2[N+](=O)[O-])CC1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C24H30F3N7O4/c25-24(26,27)38-20-6-2-1-4-16(20)13-30-23-31-14-19(34(36)37)21(33-23)29-12-15-7-9-17(10-8-15)32-22(35)18-5-3-11-28-18/h1-2,4,6,14-15,17-18,28H,3,5,7-13H2,(H,32,35)(H2,29,30,31,33)/t15?,17?,18-/m0/s1 |
| InChIKey | VWSGHLOTAKALDK-VJFUWPCTSA-N |
| XLogP | 3.73 |
| TPSA | 143.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|