C21H25F3N6O3 — CID 163964526
4-N-[[4-(dimethylamino)cyclohexylidene]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 163964526) has the molecular formula C21H25F3N6O3 and a molecular weight of 466.46 g/mol. Its IUPAC name is 4-N-[[4-(dimethylamino)cyclohexylidene]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[[4-(dimethylamino)cyclohexylidene]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 163964526 |
| Molecular Formula | C21H25F3N6O3 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 4-N-[[4-(dimethylamino)cyclohexylidene]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | CN(C)C1CCC(=CNc2nc(NCc3ccccc3OC(F)(F)F)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H25F3N6O3/c1-29(2)16-9-7-14(8-10-16)11-25-19-17(30(31)32)13-27-20(28-19)26-12-15-5-3-4-6-18(15)33-21(22,23)24/h3-6,11,13,16H,7-10,12H2,1-2H3,(H2,25,26,27,28)/b14-11- |
| InChIKey | IWSGBJYIBBIJLY-KAMYIIQDSA-N |
| XLogP | 4.70 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|