C31H36F3N7O4 — CID 69347914
N-[1-[4-[(N-[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]anilino)methyl]cyclohexyl]pyrrolidin-3-yl]acetamide (PubChem CID 69347914) has the molecular formula C31H36F3N7O4 and a molecular weight of 627.67 g/mol. Its IUPAC name is N-[1-[4-[(N-[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]anilino)methyl]cyclohexyl]pyrrolidin-3-yl]acetamide.
| Compound Name | N-[1-[4-[(N-[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]anilino)methyl]cyclohexyl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 69347914 |
| Molecular Formula | C31H36F3N7O4 |
| Molecular Weight | 627.67 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | N-[1-[4-[(N-[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]anilino)methyl]cyclohexyl]pyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCN(C2CCC(CN(c3ccccc3)c3nc(NCc4ccccc4OC(F)(F)F)ncc3[N+](=O)[O-])CC2)C1 |
| InChI | InChI=1S/C31H36F3N7O4/c1-21(42)37-24-15-16-39(20-24)25-13-11-22(12-14-25)19-40(26-8-3-2-4-9-26)29-27(41(43)44)18-36-30(38-29)35-17-23-7-5-6-10-28(23)45-31(32,33)34/h2-10,18,22,24-25H,11-17,19-20H2,1H3,(H,37,42)(H,35,36,38) |
| InChIKey | GUZMWEVWGJPZCB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.67 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|