C28H33F3N6O4 — CID 69347179
3-[[4-[(N-[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]anilino)methyl]cyclohexyl]amino]propan-1-ol (PubChem CID 69347179) has the molecular formula C28H33F3N6O4 and a molecular weight of 574.60 g/mol. Its IUPAC name is 3-[[4-[(N-[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]anilino)methyl]cyclohexyl]amino]propan-1-ol.
| Compound Name | 3-[[4-[(N-[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]anilino)methyl]cyclohexyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 69347179 |
| Molecular Formula | C28H33F3N6O4 |
| Molecular Weight | 574.60 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | 3-[[4-[(N-[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]anilino)methyl]cyclohexyl]amino]propan-1-ol |
| SMILES | O=[N+]([O-])c1cnc(NCc2ccccc2OC(F)(F)F)nc1N(CC1CCC(NCCCO)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H33F3N6O4/c29-28(30,31)41-25-10-5-4-7-21(25)17-33-27-34-18-24(37(39)40)26(35-27)36(23-8-2-1-3-9-23)19-20-11-13-22(14-12-20)32-15-6-16-38/h1-5,7-10,18,20,22,32,38H,6,11-17,19H2,(H,33,34,35) |
| InChIKey | ZIJIKDUZFBZSJA-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|