C25H37N7O5 — CID 69063737
tert-butyl N-[4-[[[5-nitro-2-[(2-propan-2-yloxy-3-pyridinyl)methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]carbamate (PubChem CID 69063737) has the molecular formula C25H37N7O5 and a molecular weight of 515.62 g/mol. Its IUPAC name is tert-butyl N-[4-[[[5-nitro-2-[(2-propan-2-yloxy-3-pyridinyl)methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[[5-nitro-2-[(2-propan-2-yloxy-3-pyridinyl)methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 69063737 |
| Molecular Formula | C25H37N7O5 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | tert-butyl N-[4-[[[5-nitro-2-[(2-propan-2-yloxy-3-pyridinyl)methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]carbamate |
| SMILES | CC(C)Oc1ncccc1CNc1ncc([N+](=O)[O-])c(NCC2CCC(NC(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C25H37N7O5/c1-16(2)36-22-18(7-6-12-26-22)14-28-23-29-15-20(32(34)35)21(31-23)27-13-17-8-10-19(11-9-17)30-24(33)37-25(3,4)5/h6-7,12,15-17,19H,8-11,13-14H2,1-5H3,(H,30,33)(H2,27,28,29,31) |
| InChIKey | ZQMDHEWAOCXEBU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 153.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|