C28H40N8O7 — CID 69175265
2-[[3-[[[4-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]benzoyl]amino]ethylcarbamic acid (PubChem CID 69175265) has the molecular formula C28H40N8O7 and a molecular weight of 600.68 g/mol. Its IUPAC name is 2-[[3-[[[4-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]benzoyl]amino]ethylcarbamic acid.
| Compound Name | 2-[[3-[[[4-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]benzoyl]amino]ethylcarbamic acid |
|---|---|
| PubChem CID | 69175265 |
| Molecular Formula | C28H40N8O7 |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.30 |
| IUPAC Name | 2-[[3-[[[4-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]benzoyl]amino]ethylcarbamic acid |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(CNc2nc(NCc3cccc(C(=O)NCCNC(=O)O)c3)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C28H40N8O7/c1-28(2,3)43-27(40)34-15-19-9-7-18(8-10-19)14-31-23-22(36(41)42)17-33-25(35-23)32-16-20-5-4-6-21(13-20)24(37)29-11-12-30-26(38)39/h4-6,13,17-19,30H,7-12,14-16H2,1-3H3,(H,29,37)(H,34,40)(H,38,39)(H2,31,32,33,35) |
| InChIKey | UZCYEHROLNIEHB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 209.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|