C35H45N7O5 — CID 71043132
cyclopentyl (2R)-2-[[3-[3-[[[4-[[4-(aminomethyl)cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-2-methylphenyl]benzoyl]amino]propanoate (PubChem CID 71043132) has the molecular formula C35H45N7O5 and a molecular weight of 643.79 g/mol. Its IUPAC name is cyclopentyl (2R)-2-[[3-[3-[[[4-[[4-(aminomethyl)cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-2-methylphenyl]benzoyl]amino]propanoate.
| Compound Name | cyclopentyl (2R)-2-[[3-[3-[[[4-[[4-(aminomethyl)cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-2-methylphenyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 71043132 |
| Molecular Formula | C35H45N7O5 |
| Molecular Weight | 643.79 g/mol |
| Exact Mass | 643.35 |
| IUPAC Name | cyclopentyl (2R)-2-[[3-[3-[[[4-[[4-(aminomethyl)cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-2-methylphenyl]benzoyl]amino]propanoate |
| SMILES | Cc1c(CNc2ncc([N+](=O)[O-])c(NCC3CCC(CN)CC3)n2)cccc1-c1cccc(C(=O)N[C@H](C)C(=O)OC2CCCC2)c1 |
| InChI | InChI=1S/C35H45N7O5/c1-22-28(20-38-35-39-21-31(42(45)46)32(41-35)37-19-25-15-13-24(18-36)14-16-25)9-6-12-30(22)26-7-5-8-27(17-26)33(43)40-23(2)34(44)47-29-10-3-4-11-29/h5-9,12,17,21,23-25,29H,3-4,10-11,13-16,18-20,36H2,1-2H3,(H,40,43)(H2,37,38,39,41)/t23-,24?,25?/m1/s1 |
| InChIKey | DHPMSPCQBDVRCV-CZUALIRWSA-N |
| XLogP | 5.75 |
| TPSA | 174.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.79 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|