C27H35N7O4S — CID 24768755
N-[4-[[[2-[[3-[3-(aminomethyl)phenyl]-2-methylphenyl]methylamino]-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]methanesulfonamide (PubChem CID 24768755) has the molecular formula C27H35N7O4S and a molecular weight of 553.69 g/mol. Its IUPAC name is N-[4-[[[2-[[3-[3-(aminomethyl)phenyl]-2-methylphenyl]methylamino]-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]methanesulfonamide.
| Compound Name | N-[4-[[[2-[[3-[3-(aminomethyl)phenyl]-2-methylphenyl]methylamino]-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 24768755 |
| Molecular Formula | C27H35N7O4S |
| Molecular Weight | 553.69 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | N-[4-[[[2-[[3-[3-(aminomethyl)phenyl]-2-methylphenyl]methylamino]-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]methanesulfonamide |
| SMILES | Cc1c(CNc2ncc([N+](=O)[O-])c(NCC3CCC(NS(C)(=O)=O)CC3)n2)cccc1-c1cccc(CN)c1 |
| InChI | InChI=1S/C27H35N7O4S/c1-18-22(7-4-8-24(18)21-6-3-5-20(13-21)14-28)16-30-27-31-17-25(34(35)36)26(32-27)29-15-19-9-11-23(12-10-19)33-39(2,37)38/h3-8,13,17,19,23,33H,9-12,14-16,28H2,1-2H3,(H2,29,30,31,32) |
| InChIKey | NYKCQXZKXNTKKS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 165.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.69 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|