C30H37N7O2 — CID 142928208
4-N-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[[3-[1-[[(E)-2-(2-methylphenyl)ethenyl]amino]ethenyl]phenyl]methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 142928208) has the molecular formula C30H37N7O2 and a molecular weight of 527.67 g/mol. Its IUPAC name is 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[[3-[1-[[(E)-2-(2-methylphenyl)ethenyl]amino]ethenyl]phenyl]methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[[3-[1-[[(E)-2-(2-methylphenyl)ethenyl]amino]ethenyl]phenyl]methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 142928208 |
| Molecular Formula | C30H37N7O2 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[[3-[1-[[(E)-2-(2-methylphenyl)ethenyl]amino]ethenyl]phenyl]methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | C=C(N/C=C/c1ccccc1C)c1cccc(CNc2ncc([N+](=O)[O-])c(NCC3CCC(CN)CC3)n2)c1 |
| InChI | InChI=1S/C30H37N7O2/c1-21-6-3-4-8-26(21)14-15-32-22(2)27-9-5-7-25(16-27)19-34-30-35-20-28(37(38)39)29(36-30)33-18-24-12-10-23(17-31)11-13-24/h3-9,14-16,20,23-24,32H,2,10-13,17-19,31H2,1H3,(H2,33,34,35,36)/b15-14+ |
| InChIKey | BXPLPWWFEIQCFJ-CCEZHUSRSA-N |
| XLogP | 5.71 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|