C21H28N6O2 — CID 10250159
4-N-[[4-(aminomethyl)cyclohexyl]methyl]-5-nitro-2-N-(1-phenylcyclopropyl)pyrimidine-2,4-diamine (PubChem CID 10250159) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-5-nitro-2-N-(1-phenylcyclopropyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-5-nitro-2-N-(1-phenylcyclopropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 10250159 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-5-nitro-2-N-(1-phenylcyclopropyl)pyrimidine-2,4-diamine |
| SMILES | NCC1CCC(CNc2nc(NC3(c4ccccc4)CC3)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H28N6O2/c22-12-15-6-8-16(9-7-15)13-23-19-18(27(28)29)14-24-20(25-19)26-21(10-11-21)17-4-2-1-3-5-17/h1-5,14-16H,6-13,22H2,(H2,23,24,25,26) |
| InChIKey | XAXGLQAEDIVRSJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|