C26H33N7O3 — CID 24768704
[4-[[[2-[[3-[6-(aminomethyl)-3-pyridinyl]-2-methylphenyl]methylamino]-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]methanol (PubChem CID 24768704) has the molecular formula C26H33N7O3 and a molecular weight of 491.60 g/mol. Its IUPAC name is [4-[[[2-[[3-[6-(aminomethyl)-3-pyridinyl]-2-methylphenyl]methylamino]-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]methanol.
| Compound Name | [4-[[[2-[[3-[6-(aminomethyl)-3-pyridinyl]-2-methylphenyl]methylamino]-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 24768704 |
| Molecular Formula | C26H33N7O3 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | [4-[[[2-[[3-[6-(aminomethyl)-3-pyridinyl]-2-methylphenyl]methylamino]-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]methanol |
| SMILES | Cc1c(CNc2ncc([N+](=O)[O-])c(NCC3CCC(CO)CC3)n2)cccc1-c1ccc(CN)nc1 |
| InChI | InChI=1S/C26H33N7O3/c1-17-20(3-2-4-23(17)21-9-10-22(11-27)28-14-21)13-30-26-31-15-24(33(35)36)25(32-26)29-12-18-5-7-19(16-34)8-6-18/h2-4,9-10,14-15,18-19,34H,5-8,11-13,16,27H2,1H3,(H2,29,30,31,32) |
| InChIKey | MKPDUKIRLDULCY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 152.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|