C32H40N6O5 — CID 71043133
oxolan-2-ylmethyl 3-[3-[[[4-[[4-(aminomethyl)cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-2-methylphenyl]benzoate (PubChem CID 71043133) has the molecular formula C32H40N6O5 and a molecular weight of 588.71 g/mol. Its IUPAC name is oxolan-2-ylmethyl 3-[3-[[[4-[[4-(aminomethyl)cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-2-methylphenyl]benzoate.
| Compound Name | oxolan-2-ylmethyl 3-[3-[[[4-[[4-(aminomethyl)cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-2-methylphenyl]benzoate |
|---|---|
| PubChem CID | 71043133 |
| Molecular Formula | C32H40N6O5 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | oxolan-2-ylmethyl 3-[3-[[[4-[[4-(aminomethyl)cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-2-methylphenyl]benzoate |
| SMILES | Cc1c(CNc2ncc([N+](=O)[O-])c(NCC3CCC(CN)CC3)n2)cccc1-c1cccc(C(=O)OCC2CCCO2)c1 |
| InChI | InChI=1S/C32H40N6O5/c1-21-26(7-3-9-28(21)24-5-2-6-25(15-24)31(39)43-20-27-8-4-14-42-27)18-35-32-36-19-29(38(40)41)30(37-32)34-17-23-12-10-22(16-33)11-13-23/h2-3,5-7,9,15,19,22-23,27H,4,8,10-14,16-18,20,33H2,1H3,(H2,34,35,36,37) |
| InChIKey | PHSGTGFTBGPYIJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|