C34H43N7O5S — CID 71472331
3-[3-[[[4-[[4-(aminomethyl)cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-2-methylphenyl]-N-[3-(2-oxooxolan-3-yl)sulfanylpropyl]benzamide (PubChem CID 71472331) has the molecular formula C34H43N7O5S and a molecular weight of 661.83 g/mol. Its IUPAC name is 3-[3-[[[4-[[4-(aminomethyl)cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-2-methylphenyl]-N-[3-(2-oxooxolan-3-yl)sulfanylpropyl]benzamide.
| Compound Name | 3-[3-[[[4-[[4-(aminomethyl)cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-2-methylphenyl]-N-[3-(2-oxooxolan-3-yl)sulfanylpropyl]benzamide |
|---|---|
| PubChem CID | 71472331 |
| Molecular Formula | C34H43N7O5S |
| Molecular Weight | 661.83 g/mol |
| Exact Mass | 661.30 |
| IUPAC Name | 3-[3-[[[4-[[4-(aminomethyl)cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-2-methylphenyl]-N-[3-(2-oxooxolan-3-yl)sulfanylpropyl]benzamide |
| SMILES | Cc1c(CNc2ncc([N+](=O)[O-])c(NCC3CCC(CN)CC3)n2)cccc1-c1cccc(C(=O)NCCCSC2CCOC2=O)c1 |
| InChI | InChI=1S/C34H43N7O5S/c1-22-27(20-38-34-39-21-29(41(44)45)31(40-34)37-19-24-11-9-23(18-35)10-12-24)7-3-8-28(22)25-5-2-6-26(17-25)32(42)36-14-4-16-47-30-13-15-46-33(30)43/h2-3,5-8,17,21,23-24,30H,4,9-16,18-20,35H2,1H3,(H,36,42)(H2,37,38,39,40) |
| InChIKey | GMNFOPANZKSZNG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 174.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.83 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|