C20H34N6O3 — CID 59845667
cis-(1R,3R)-3-[[[4-[(4-aminocyclohexyl)methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-4,4-dimethylcyclohexan-1-ol (PubChem CID 59845667) has the molecular formula C20H34N6O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is cis-(1R,3R)-3-[[[4-[(4-aminocyclohexyl)methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-4,4-dimethylcyclohexan-1-ol.
| Compound Name | cis-(1R,3R)-3-[[[4-[(4-aminocyclohexyl)methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-4,4-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 59845667 |
| Molecular Formula | C20H34N6O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | cis-(1R,3R)-3-[[[4-[(4-aminocyclohexyl)methylamino]-5-nitropyrimidin-2-yl]amino]methyl]-4,4-dimethylcyclohexan-1-ol |
| SMILES | CC1(C)CC[C@@H](O)C[C@H]1CNc1ncc([N+](=O)[O-])c(NCC2CCC(N)CC2)n1 |
| InChI | InChI=1S/C20H34N6O3/c1-20(2)8-7-16(27)9-14(20)11-23-19-24-12-17(26(28)29)18(25-19)22-10-13-3-5-15(21)6-4-13/h12-16,27H,3-11,21H2,1-2H3,(H2,22,23,24,25)/t13?,14-,15?,16+/m0/s1 |
| InChIKey | KRPSNTDOEOXGAA-BHDPWAOGSA-N |
| XLogP | 2.91 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|