C11H16ClN5O4 — CID 88992170
tert-butyl N-[2-[(2-chloro-5-nitropyrimidin-4-yl)amino]ethyl]carbamate (PubChem CID 88992170) has the molecular formula C11H16ClN5O4 and a molecular weight of 317.73 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-chloro-5-nitropyrimidin-4-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-chloro-5-nitropyrimidin-4-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 88992170 |
| Molecular Formula | C11H16ClN5O4 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | tert-butyl N-[2-[(2-chloro-5-nitropyrimidin-4-yl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1nc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16ClN5O4/c1-11(2,3)21-10(18)14-5-4-13-8-7(17(19)20)6-15-9(12)16-8/h6H,4-5H2,1-3H3,(H,14,18)(H,13,15,16) |
| InChIKey | OEUOIBLFJPXDAK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|