C15H22ClN5O4 — CID 59868012
tert-butyl 4-[[(2-chloro-5-nitropyrimidin-4-yl)amino]methyl]piperidine-1-carboxylate (PubChem CID 59868012) has the molecular formula C15H22ClN5O4 and a molecular weight of 371.83 g/mol. Its IUPAC name is tert-butyl 4-[[(2-chloro-5-nitropyrimidin-4-yl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(2-chloro-5-nitropyrimidin-4-yl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59868012 |
| Molecular Formula | C15H22ClN5O4 |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | tert-butyl 4-[[(2-chloro-5-nitropyrimidin-4-yl)amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNc2nc(Cl)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H22ClN5O4/c1-15(2,3)25-14(22)20-6-4-10(5-7-20)8-17-12-11(21(23)24)9-18-13(16)19-12/h9-10H,4-8H2,1-3H3,(H,17,18,19) |
| InChIKey | NKPDBDJFXNNNGN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|