C17H26ClN5O4 — CID 139996433
tert-butyl 4-[2-[(2-chloro-6-methyl-5-nitropyrimidin-4-yl)amino]ethyl]piperidine-1-carboxylate (PubChem CID 139996433) has the molecular formula C17H26ClN5O4 and a molecular weight of 399.88 g/mol. Its IUPAC name is tert-butyl 4-[2-[(2-chloro-6-methyl-5-nitropyrimidin-4-yl)amino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(2-chloro-6-methyl-5-nitropyrimidin-4-yl)amino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139996433 |
| Molecular Formula | C17H26ClN5O4 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | tert-butyl 4-[2-[(2-chloro-6-methyl-5-nitropyrimidin-4-yl)amino]ethyl]piperidine-1-carboxylate |
| SMILES | Cc1nc(Cl)nc(NCCC2CCN(C(=O)OC(C)(C)C)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H26ClN5O4/c1-11-13(23(25)26)14(21-15(18)20-11)19-8-5-12-6-9-22(10-7-12)16(24)27-17(2,3)4/h12H,5-10H2,1-4H3,(H,19,20,21) |
| InChIKey | UDATUAVISIMNJD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|