C19H26ClN5O5 — CID 87631824
tert-butyl 4-[[2-chloro-6-(3,6-dihydro-2H-pyran-4-yl)-5-nitropyrimidin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 87631824) has the molecular formula C19H26ClN5O5 and a molecular weight of 439.90 g/mol. Its IUPAC name is tert-butyl 4-[[2-chloro-6-(3,6-dihydro-2H-pyran-4-yl)-5-nitropyrimidin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-chloro-6-(3,6-dihydro-2H-pyran-4-yl)-5-nitropyrimidin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87631824 |
| Molecular Formula | C19H26ClN5O5 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | tert-butyl 4-[[2-chloro-6-(3,6-dihydro-2H-pyran-4-yl)-5-nitropyrimidin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2nc(Cl)nc(C3=CCOCC3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H26ClN5O5/c1-19(2,3)30-18(26)24-8-4-13(5-9-24)21-16-15(25(27)28)14(22-17(20)23-16)12-6-10-29-11-7-12/h6,13H,4-5,7-11H2,1-3H3,(H,21,22,23) |
| InChIKey | URFVNGGCZCFTDR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|