C19H28N4O6 — CID 172563814
tert-butyl 4-[[2-nitro-5-(oxolan-3-yloxy)-3-pyridinyl]amino]piperidine-1-carboxylate (PubChem CID 172563814) has the molecular formula C19H28N4O6 and a molecular weight of 408.46 g/mol. Its IUPAC name is tert-butyl 4-[[2-nitro-5-(oxolan-3-yloxy)-3-pyridinyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-nitro-5-(oxolan-3-yloxy)-3-pyridinyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172563814 |
| Molecular Formula | C19H28N4O6 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | tert-butyl 4-[[2-nitro-5-(oxolan-3-yloxy)-3-pyridinyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cc(OC3CCOC3)cnc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H28N4O6/c1-19(2,3)29-18(24)22-7-4-13(5-8-22)21-16-10-15(11-20-17(16)23(25)26)28-14-6-9-27-12-14/h10-11,13-14,21H,4-9,12H2,1-3H3 |
| InChIKey | ZVGLHBPEGYFTBT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|