C15H21BrN4O4 — CID 68897720
tert-butyl 4-[(3-bromo-5-nitro-4-pyridinyl)amino]piperidine-1-carboxylate (PubChem CID 68897720) has the molecular formula C15H21BrN4O4 and a molecular weight of 401.26 g/mol. Its IUPAC name is tert-butyl 4-[(3-bromo-5-nitro-4-pyridinyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-bromo-5-nitro-4-pyridinyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68897720 |
| Molecular Formula | C15H21BrN4O4 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | tert-butyl 4-[(3-bromo-5-nitro-4-pyridinyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2c(Br)cncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H21BrN4O4/c1-15(2,3)24-14(21)19-6-4-10(5-7-19)18-13-11(16)8-17-9-12(13)20(22)23/h8-10H,4-7H2,1-3H3,(H,17,18) |
| InChIKey | NCRHMLGTVCMLFU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|