C12H15BrN4O3 — CID 103519286
4-[(3-bromo-5-nitro-4-pyridinyl)amino]cyclohexane-1-carboxamide (PubChem CID 103519286) has the molecular formula C12H15BrN4O3 and a molecular weight of 343.18 g/mol. Its IUPAC name is 4-[(3-bromo-5-nitro-4-pyridinyl)amino]cyclohexane-1-carboxamide.
| Compound Name | 4-[(3-bromo-5-nitro-4-pyridinyl)amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 103519286 |
| Molecular Formula | C12H15BrN4O3 |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 4-[(3-bromo-5-nitro-4-pyridinyl)amino]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCC(Nc2c(Br)cncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H15BrN4O3/c13-9-5-15-6-10(17(19)20)11(9)16-8-3-1-7(2-4-8)12(14)18/h5-8H,1-4H2,(H2,14,18)(H,15,16) |
| InChIKey | UATPYFIIHIPNAK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|