C11H14BrN3O2S — CID 114121837
3-bromo-N-(2-methylsulfanylcyclopentyl)-5-nitropyridin-4-amine (PubChem CID 114121837) has the molecular formula C11H14BrN3O2S and a molecular weight of 332.22 g/mol. Its IUPAC name is 3-bromo-N-(2-methylsulfanylcyclopentyl)-5-nitropyridin-4-amine.
| Compound Name | 3-bromo-N-(2-methylsulfanylcyclopentyl)-5-nitropyridin-4-amine |
|---|---|
| PubChem CID | 114121837 |
| Molecular Formula | C11H14BrN3O2S |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 3-bromo-N-(2-methylsulfanylcyclopentyl)-5-nitropyridin-4-amine |
| SMILES | CSC1CCCC1Nc1c(Br)cncc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14BrN3O2S/c1-18-10-4-2-3-8(10)14-11-7(12)5-13-6-9(11)15(16)17/h5-6,8,10H,2-4H2,1H3,(H,13,14) |
| InChIKey | MXMHLKNICJUZHZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|