C10H12BrN3O4S — CID 103519265
3-bromo-N-(1,1-dioxothian-4-yl)-5-nitropyridin-4-amine (PubChem CID 103519265) has the molecular formula C10H12BrN3O4S and a molecular weight of 350.19 g/mol. Its IUPAC name is 3-bromo-N-(1,1-dioxothian-4-yl)-5-nitropyridin-4-amine.
| Compound Name | 3-bromo-N-(1,1-dioxothian-4-yl)-5-nitropyridin-4-amine |
|---|---|
| PubChem CID | 103519265 |
| Molecular Formula | C10H12BrN3O4S |
| Molecular Weight | 350.19 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 3-bromo-N-(1,1-dioxothian-4-yl)-5-nitropyridin-4-amine |
| SMILES | O=[N+]([O-])c1cncc(Br)c1NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H12BrN3O4S/c11-8-5-12-6-9(14(15)16)10(8)13-7-1-3-19(17,18)4-2-7/h5-7H,1-4H2,(H,12,13) |
| InChIKey | QTRCYFVLJYESKT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|