C19H27ClN4O6 — CID 59291839
tert-butyl 4-[(2-chloro-5-ethoxycarbonyl-3-nitro-4-pyridinyl)amino]azepane-1-carboxylate (PubChem CID 59291839) has the molecular formula C19H27ClN4O6 and a molecular weight of 442.90 g/mol. Its IUPAC name is tert-butyl 4-[(2-chloro-5-ethoxycarbonyl-3-nitro-4-pyridinyl)amino]azepane-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-chloro-5-ethoxycarbonyl-3-nitro-4-pyridinyl)amino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 59291839 |
| Molecular Formula | C19H27ClN4O6 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | tert-butyl 4-[(2-chloro-5-ethoxycarbonyl-3-nitro-4-pyridinyl)amino]azepane-1-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)c([N+](=O)[O-])c1NC1CCCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H27ClN4O6/c1-5-29-17(25)13-11-21-16(20)15(24(27)28)14(13)22-12-7-6-9-23(10-8-12)18(26)30-19(2,3)4/h11-12H,5-10H2,1-4H3,(H,21,22) |
| InChIKey | VIOZJNKVZLVGCG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|